About 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane
4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane (PubChem CID 171762031) has the molecular formula C6H11FO2
and a molecular weight of 134.15 g/mol. Its IUPAC name is 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane |
| PubChem CID | 171762031 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane |
| SMILES | CC1OC(C)C(CF)O1 |
| InChI | InChI=1S/C6H11FO2/c1-4-6(3-7)9-5(2)8-4/h4-6H,3H2,1-2H3 |
| InChIKey | CAUWPLHCHACWKD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane?
The IUPAC name of 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane (CID 171762031) is 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane.
What is the SMILES notation for 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane?
The canonical SMILES for 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane is CC1OC(C)C(CF)O1.
What is the InChIKey of 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane?
The InChIKey is CAUWPLHCHACWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO2/c1-4-6(3-7)9-5(2)8-4/h4-6H,3H2,1-2H3.
What are the key properties of 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane?
4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane has a molecular weight of 134.15 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane is sourced from PubChem (CID 171762031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).