C6H11FO2 — CID 171762031
4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane (PubChem CID 171762031) has the molecular formula C6H11FO2 and a molecular weight of 134.15 g/mol. Its IUPAC name is 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane.
| Compound Name | 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 171762031 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-(fluoromethyl)-2,5-dimethyl-1,3-dioxolane |
| SMILES | CC1OC(C)C(CF)O1 |
| InChI | InChI=1S/C6H11FO2/c1-4-6(3-7)9-5(2)8-4/h4-6H,3H2,1-2H3 |
| InChIKey | CAUWPLHCHACWKD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |