C5H8FIO3 — CID 139745602
(2R,3S,4R)-5-fluoro-2-(hydroxymethyl)-4-iodooxolan-3-ol (PubChem CID 139745602) has the molecular formula C5H8FIO3 and a molecular weight of 262.02 g/mol. Its IUPAC name is (2R,3S,4R)-5-fluoro-2-(hydroxymethyl)-4-iodooxolan-3-ol.
| Compound Name | (2R,3S,4R)-5-fluoro-2-(hydroxymethyl)-4-iodooxolan-3-ol |
|---|---|
| PubChem CID | 139745602 |
| Molecular Formula | C5H8FIO3 |
| Molecular Weight | 262.02 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | (2R,3S,4R)-5-fluoro-2-(hydroxymethyl)-4-iodooxolan-3-ol |
| SMILES | OC[C@H]1OC(F)[C@H](I)[C@H]1O |
| InChI | InChI=1S/C5H8FIO3/c6-5-3(7)4(9)2(1-8)10-5/h2-5,8-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChIKey | CYYNZKPFYDJDQE-ZRMNMSDTSA-N |
| XLogP | -0.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.02 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|