C5H9IO4 — CID 150341486
(2S,3R,4R)-2-(hydroxymethyl)-5-iodooxolane-3,4-diol (PubChem CID 150341486) has the molecular formula C5H9IO4 and a molecular weight of 260.03 g/mol. Its IUPAC name is (2S,3R,4R)-2-(hydroxymethyl)-5-iodooxolane-3,4-diol.
| Compound Name | (2S,3R,4R)-2-(hydroxymethyl)-5-iodooxolane-3,4-diol |
|---|---|
| PubChem CID | 150341486 |
| Molecular Formula | C5H9IO4 |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | (2S,3R,4R)-2-(hydroxymethyl)-5-iodooxolane-3,4-diol |
| SMILES | OC[C@@H]1OC(I)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C5H9IO4/c6-5-4(9)3(8)2(1-7)10-5/h2-5,7-9H,1H2/t2-,3-,4+,5?/m0/s1 |
| InChIKey | GRUKJJJSNRHWKR-HWQSCIPKSA-N |
| XLogP | -1.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|