C6H10FIO4 — CID 139745590
(2R,3R,4R,5R)-6-fluoro-2-(hydroxymethyl)-5-iodooxane-3,4-diol (PubChem CID 139745590) has the molecular formula C6H10FIO4 and a molecular weight of 292.04 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-fluoro-2-(hydroxymethyl)-5-iodooxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-6-fluoro-2-(hydroxymethyl)-5-iodooxane-3,4-diol |
|---|---|
| PubChem CID | 139745590 |
| Molecular Formula | C6H10FIO4 |
| Molecular Weight | 292.04 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | (2R,3R,4R,5R)-6-fluoro-2-(hydroxymethyl)-5-iodooxane-3,4-diol |
| SMILES | OC[C@H]1OC(F)[C@H](I)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10FIO4/c7-6-3(8)5(11)4(10)2(1-9)12-6/h2-6,9-11H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | GFUZOVCUTIQGIL-QTVWNMPRSA-N |
| XLogP | -0.80 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.04 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|