C7H13IO3 — CID 59426747
5-iodo-2,6-dimethyloxane-3,4-diol (PubChem CID 59426747) has the molecular formula C7H13IO3 and a molecular weight of 272.08 g/mol. Its IUPAC name is 5-iodo-2,6-dimethyloxane-3,4-diol.
| Compound Name | 5-iodo-2,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 59426747 |
| Molecular Formula | C7H13IO3 |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 5-iodo-2,6-dimethyloxane-3,4-diol |
| SMILES | CC1OC(C)C(I)C(O)C1O |
| InChI | InChI=1S/C7H13IO3/c1-3-5(8)7(10)6(9)4(2)11-3/h3-7,9-10H,1-2H3 |
| InChIKey | AJPCICQUNGJOFW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|