C13H26O — CID 91375231
2,3,5-triethyl-4,6-dimethyloxane (PubChem CID 91375231) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,3,5-triethyl-4,6-dimethyloxane.
| Compound Name | 2,3,5-triethyl-4,6-dimethyloxane |
|---|---|
| PubChem CID | 91375231 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2,3,5-triethyl-4,6-dimethyloxane |
| SMILES | CCC1OC(C)C(CC)C(C)C1CC |
| InChI | InChI=1S/C13H26O/c1-6-11-9(4)12(7-2)13(8-3)14-10(11)5/h9-13H,6-8H2,1-5H3 |
| InChIKey | LMDOBOUMVXZCNW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |