C15H30O2 — CID 159309218
1,3-dimethylcyclobutane;2,3-dimethyloxirane;2-ethyl-3-methyloxirane (PubChem CID 159309218) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 1,3-dimethylcyclobutane;2,3-dimethyloxirane;2-ethyl-3-methyloxirane.
| Compound Name | 1,3-dimethylcyclobutane;2,3-dimethyloxirane;2-ethyl-3-methyloxirane |
|---|---|
| PubChem CID | 159309218 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1,3-dimethylcyclobutane;2,3-dimethyloxirane;2-ethyl-3-methyloxirane |
| SMILES | CC1CC(C)C1.CC1OC1C.CCC1OC1C |
| InChI | InChI=1S/C6H12.C5H10O.C4H8O/c1-5-3-6(2)4-5;1-3-5-4(2)6-5;1-3-4(2)5-3/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | LCHYFRVROIELHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|