About 2-ethyl-3-methoxy-5,6-dimethyloxane
2-ethyl-3-methoxy-5,6-dimethyloxane (PubChem CID 148593418) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethyl-3-methoxy-5,6-dimethyloxane.
Molecular Properties
| Compound Name | 2-ethyl-3-methoxy-5,6-dimethyloxane |
| PubChem CID | 148593418 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-ethyl-3-methoxy-5,6-dimethyloxane |
| SMILES | CCC1OC(C)C(C)CC1OC |
| InChI | InChI=1S/C10H20O2/c1-5-9-10(11-4)6-7(2)8(3)12-9/h7-10H,5-6H2,1-4H3 |
| InChIKey | VPXPSONLRXCQCE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-methoxy-5,6-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methoxy-5,6-dimethyloxane?
The IUPAC name of 2-ethyl-3-methoxy-5,6-dimethyloxane (CID 148593418) is 2-ethyl-3-methoxy-5,6-dimethyloxane.
What is the SMILES notation for 2-ethyl-3-methoxy-5,6-dimethyloxane?
The canonical SMILES for 2-ethyl-3-methoxy-5,6-dimethyloxane is CCC1OC(C)C(C)CC1OC.
What is the InChIKey of 2-ethyl-3-methoxy-5,6-dimethyloxane?
The InChIKey is VPXPSONLRXCQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-5-9-10(11-4)6-7(2)8(3)12-9/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-ethyl-3-methoxy-5,6-dimethyloxane?
2-ethyl-3-methoxy-5,6-dimethyloxane has a molecular weight of 172.27 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methoxy-5,6-dimethyloxane is sourced from PubChem (CID 148593418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).