About CID 59804709
CID 59804709 (PubChem CID 59804709) has the molecular formula C7H13BO2
and a molecular weight of 139.99 g/mol.
Molecular Properties
| Compound Name | CID 59804709 |
| PubChem CID | 59804709 |
| Molecular Formula | C7H13BO2 |
| Molecular Weight | 139.99 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](OC)[C@@H](CC)O1 |
| InChI | InChI=1S/C7H13BO2/c1-3-5-6(9-2)4-7(8)10-5/h5-7H,3-4H2,1-2H3/t5-,6-,7-/m1/s1 |
| InChIKey | PXXXIKUXFNLPNC-FSDSQADBSA-N |
| XLogP | 0.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.99 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59804709 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59804709?
The IUPAC name of CID 59804709 (CID 59804709) is not available.
What is the SMILES notation for CID 59804709?
The canonical SMILES for CID 59804709 is [B][C@H]1C[C@@H](OC)[C@@H](CC)O1.
What is the InChIKey of CID 59804709?
The InChIKey is PXXXIKUXFNLPNC-FSDSQADBSA-N. The full InChI is InChI=1S/C7H13BO2/c1-3-5-6(9-2)4-7(8)10-5/h5-7H,3-4H2,1-2H3/t5-,6-,7-/m1/s1.
What are the key properties of CID 59804709?
CID 59804709 has a molecular weight of 139.99 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59804709 is sourced from PubChem (CID 59804709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).