About ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane
ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane (PubChem CID 158159341) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane |
| PubChem CID | 158159341 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane |
| SMILES | C1CCC2OC2C1.CC.CCC1OC1C |
| InChI | InChI=1S/C6H10O.C5H10O.C2H6/c1-2-4-6-5(3-1)7-6;1-3-5-4(2)6-5;1-2/h5-6H,1-4H2;4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | FWBSBRLDBGRFDS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane?
The IUPAC name of ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane (CID 158159341) is ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane.
What is the SMILES notation for ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane?
The canonical SMILES for ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane is C1CCC2OC2C1.CC.CCC1OC1C.
What is the InChIKey of ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane?
The InChIKey is FWBSBRLDBGRFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C5H10O.C2H6/c1-2-4-6-5(3-1)7-6;1-3-5-4(2)6-5;1-2/h5-6H,1-4H2;4-5H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane?
ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane has a molecular weight of 214.35 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-3-methyloxirane;7-oxabicyclo[4.1.0]heptane is sourced from PubChem (CID 158159341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).