C12H23NO — CID 148802324
2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 148802324) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 148802324 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | CCC1NC2CCCCC2OC1CC |
| InChI | InChI=1S/C12H23NO/c1-3-9-11(4-2)14-12-8-6-5-7-10(12)13-9/h9-13H,3-8H2,1-2H3 |
| InChIKey | OOGRVEXNNJAFIT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |