C8H13NO — CID 124727328
(1R,2R,5R,6R)-9-oxa-10-azatricyclo[4.2.1.12,5]decane (PubChem CID 124727328) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (1R,2R,5R,6R)-9-oxa-10-azatricyclo[4.2.1.12,5]decane.
| Compound Name | (1R,2R,5R,6R)-9-oxa-10-azatricyclo[4.2.1.12,5]decane |
|---|---|
| PubChem CID | 124727328 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1R,2R,5R,6R)-9-oxa-10-azatricyclo[4.2.1.12,5]decane |
| SMILES | C1C[C@H]2N[C@H]1[C@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C8H13NO/c1-2-6-8-4-3-7(10-8)5(1)9-6/h5-9H,1-4H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | KHWBMJWIRDAUGM-WCTZXXKLSA-N |
| XLogP | 0.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |