C9H15N — CID 130391694
10-azatricyclo[5.2.1.02,6]decane (PubChem CID 130391694) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 10-azatricyclo[5.2.1.02,6]decane.
| Compound Name | 10-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 130391694 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 10-azatricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(N3)C2C1 |
| InChI | InChI=1S/C9H15N/c1-2-6-7(3-1)9-5-4-8(6)10-9/h6-10H,1-5H2 |
| InChIKey | ITDOBKZDWIFFIC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |