C11H20O3 — CID 85404965
2-cyclohexyl-4,6-dimethyl-1,3,5-trioxane (PubChem CID 85404965) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-cyclohexyl-4,6-dimethyl-1,3,5-trioxane.
| Compound Name | 2-cyclohexyl-4,6-dimethyl-1,3,5-trioxane |
|---|---|
| PubChem CID | 85404965 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-cyclohexyl-4,6-dimethyl-1,3,5-trioxane |
| SMILES | CC1OC(C)OC(C2CCCCC2)O1 |
| InChI | InChI=1S/C11H20O3/c1-8-12-9(2)14-11(13-8)10-6-4-3-5-7-10/h8-11H,3-7H2,1-2H3 |
| InChIKey | NMLLRTHNXDWTMB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |