C13H20O6 — CID 604949
dimethyl 2-cyclohexyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 604949) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl 2-cyclohexyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl 2-cyclohexyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 604949 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | dimethyl 2-cyclohexyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | COC(=O)C1OC(C2CCCCC2)OC1C(=O)OC |
| InChI | InChI=1S/C13H20O6/c1-16-11(14)9-10(12(15)17-2)19-13(18-9)8-6-4-3-5-7-8/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | DTJMDVHGJLMAEK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |