About 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane
4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane (PubChem CID 22216489) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane.
Analyze 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane?
The IUPAC name of 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane (CID 22216489) is 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane.
What is the SMILES notation for 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane?
The canonical SMILES for 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane is C1C2CC3OC4C5CCC(OC1C35)C24.
What is the InChIKey of 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane?
The InChIKey is GSDLUYJDRUQHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-7-10-5-3-8(13-7)11-6(1)12(10)14-9(11)4-5/h5-12H,1-4H2.
What are the key properties of 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane?
4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane has a molecular weight of 192.26 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,14-dioxapentacyclo[7.4.1.02,7.03,11.05,10]tetradecane is sourced from PubChem (CID 22216489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).