C11H16O — CID 596297
7-oxatetracyclo[6.4.0.02,6.05,10]dodecane (PubChem CID 596297) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 7-oxatetracyclo[6.4.0.02,6.05,10]dodecane.
| Compound Name | 7-oxatetracyclo[6.4.0.02,6.05,10]dodecane |
|---|---|
| PubChem CID | 596297 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 7-oxatetracyclo[6.4.0.02,6.05,10]dodecane |
| SMILES | C1CC2C3CC1C1CCC2C1O3 |
| InChI | InChI=1S/C11H16O/c1-2-8-9-4-3-7-6(1)5-10(8)12-11(7)9/h6-11H,1-5H2 |
| InChIKey | PZAFNBXGVVDFQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |