C18H31NO — CID 118464317
3-cyclohexyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran-4-amine (PubChem CID 118464317) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 3-cyclohexyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran-4-amine.
| Compound Name | 3-cyclohexyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran-4-amine |
|---|---|
| PubChem CID | 118464317 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 3-cyclohexyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran-4-amine |
| SMILES | NC1C(C2CCCCC2)CCC2C3CCCCC3OC12 |
| InChI | InChI=1S/C18H31NO/c19-17-13(12-6-2-1-3-7-12)10-11-15-14-8-4-5-9-16(14)20-18(15)17/h12-18H,1-11,19H2 |
| InChIKey | BZDHXQCLMQZMKR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |