C13H21ClO — CID 140578549
4-(chloromethyl)-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran (PubChem CID 140578549) has the molecular formula C13H21ClO and a molecular weight of 228.76 g/mol. Its IUPAC name is 4-(chloromethyl)-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran.
| Compound Name | 4-(chloromethyl)-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
|---|---|
| PubChem CID | 140578549 |
| Molecular Formula | C13H21ClO |
| Molecular Weight | 228.76 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-(chloromethyl)-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
| SMILES | ClCC1CCCC2C3CCCCC3OC12 |
| InChI | InChI=1S/C13H21ClO/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h9-13H,1-8H2 |
| InChIKey | WMOPXULMRFEQLW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|