C7H12Cl2 — CID 13129029
1,2-bis(chloromethyl)cyclopentane (PubChem CID 13129029) has the molecular formula C7H12Cl2 and a molecular weight of 167.08 g/mol. Its IUPAC name is 1,2-bis(chloromethyl)cyclopentane.
| Compound Name | 1,2-bis(chloromethyl)cyclopentane |
|---|---|
| PubChem CID | 13129029 |
| Molecular Formula | C7H12Cl2 |
| Molecular Weight | 167.08 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 1,2-bis(chloromethyl)cyclopentane |
| SMILES | ClCC1CCCC1CCl |
| InChI | InChI=1S/C7H12Cl2/c8-4-6-2-1-3-7(6)5-9/h6-7H,1-5H2 |
| InChIKey | YYIOMTOOMISDNU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|