C8H14Cl2 — CID 54577627
trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane (PubChem CID 54577627) has the molecular formula C8H14Cl2 and a molecular weight of 181.11 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane.
| Compound Name | trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane |
|---|---|
| PubChem CID | 54577627 |
| Molecular Formula | C8H14Cl2 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane |
| SMILES | ClC[C@@H]1CCCC[C@H]1CCl |
| InChI | InChI=1S/C8H14Cl2/c9-5-7-3-1-2-4-8(7)6-10/h7-8H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | WJVHONKNAYUVGV-YUMQZZPRSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|