C13H20O — CID 141144427
11-oxatetracyclo[7.5.0.02,7.010,12]tetradecane (PubChem CID 141144427) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 11-oxatetracyclo[7.5.0.02,7.010,12]tetradecane.
| Compound Name | 11-oxatetracyclo[7.5.0.02,7.010,12]tetradecane |
|---|---|
| PubChem CID | 141144427 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 11-oxatetracyclo[7.5.0.02,7.010,12]tetradecane |
| SMILES | C1CCC2C(C1)CC1C2CCC2OC21 |
| InChI | InChI=1S/C13H20O/c1-2-4-9-8(3-1)7-11-10(9)5-6-12-13(11)14-12/h8-13H,1-7H2 |
| InChIKey | GOEPNGRGTONVPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|