C8H10O3 — CID 162902554
(1S,2S,4S,6S,7S,9S)-3,8,11-trioxatetracyclo[4.4.1.02,4.07,9]undecane (PubChem CID 162902554) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1S,2S,4S,6S,7S,9S)-3,8,11-trioxatetracyclo[4.4.1.02,4.07,9]undecane.
| Compound Name | (1S,2S,4S,6S,7S,9S)-3,8,11-trioxatetracyclo[4.4.1.02,4.07,9]undecane |
|---|---|
| PubChem CID | 162902554 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1S,2S,4S,6S,7S,9S)-3,8,11-trioxatetracyclo[4.4.1.02,4.07,9]undecane |
| SMILES | C1[C@@H]2O[C@@H]2[C@@H]2C[C@@H]3O[C@@H]3[C@H]1O2 |
| InChI | InChI=1S/C8H10O3/c1-3-7-6(11-7)2-4(9-3)8-5(1)10-8/h3-8H,1-2H2/t3-,4-,5-,6-,7+,8+/m0/s1 |
| InChIKey | NDMYZNGMFOIMGY-YKOWBEQASA-N |
| XLogP | 0.08 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|