C10H14O2 — CID 156633397
2-methyl-4,9-dioxatetracyclo[5.4.0.03,5.08,10]undecane (PubChem CID 156633397) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-methyl-4,9-dioxatetracyclo[5.4.0.03,5.08,10]undecane.
| Compound Name | 2-methyl-4,9-dioxatetracyclo[5.4.0.03,5.08,10]undecane |
|---|---|
| PubChem CID | 156633397 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-methyl-4,9-dioxatetracyclo[5.4.0.03,5.08,10]undecane |
| SMILES | CC1C2CC3OC3C2CC2OC21 |
| InChI | InChI=1S/C10H14O2/c1-4-5-2-8-10(12-8)6(5)3-7-9(4)11-7/h4-10H,2-3H2,1H3 |
| InChIKey | ITKOJNWZUWDQKS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|