C8H12O — CID 163528323
(2S,4R,8S)-8-methyl-3-oxatricyclo[5.1.0.02,4]octane (PubChem CID 163528323) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (2S,4R,8S)-8-methyl-3-oxatricyclo[5.1.0.02,4]octane.
| Compound Name | (2S,4R,8S)-8-methyl-3-oxatricyclo[5.1.0.02,4]octane |
|---|---|
| PubChem CID | 163528323 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (2S,4R,8S)-8-methyl-3-oxatricyclo[5.1.0.02,4]octane |
| SMILES | CC1C2CC[C@H]3O[C@H]3C12 |
| InChI | InChI=1S/C8H12O/c1-4-5-2-3-6-8(9-6)7(4)5/h4-8H,2-3H2,1H3/t4?,5?,6-,7?,8-/m1/s1 |
| InChIKey | DQTVOFCZGIVFFV-UKPHHSARSA-N |
| XLogP | 1.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|