C11H16O3 — CID 10012908
(1'S,2'S,4'R,7'S,9'R)-9'-methylspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] (PubChem CID 10012908) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1'S,2'S,4'R,7'S,9'R)-9'-methylspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane].
| Compound Name | (1'S,2'S,4'R,7'S,9'R)-9'-methylspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
|---|---|
| PubChem CID | 10012908 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1'S,2'S,4'R,7'S,9'R)-9'-methylspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
| SMILES | C[C@@H]1[C@@H]2[C@@H]3O[C@@H]3CC[C@@H]2C12OCCO2 |
| InChI | InChI=1S/C11H16O3/c1-6-9-7(2-3-8-10(9)14-8)11(6)12-4-5-13-11/h6-10H,2-5H2,1H3/t6-,7+,8-,9+,10-/m1/s1 |
| InChIKey | ZIELIPDWKORVCG-MQIGXGKASA-N |
| XLogP | 1.17 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|