C11H16O4 — CID 88639107
(1'R,2'S,4'R,7'R)-7'-methoxyspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] (PubChem CID 88639107) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1'R,2'S,4'R,7'R)-7'-methoxyspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane].
| Compound Name | (1'R,2'S,4'R,7'R)-7'-methoxyspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
|---|---|
| PubChem CID | 88639107 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1'R,2'S,4'R,7'R)-7'-methoxyspiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
| SMILES | CO[C@]12CC[C@H]3O[C@H]3[C@H]1CC21OCCO1 |
| InChI | InChI=1S/C11H16O4/c1-12-10-3-2-8-9(15-8)7(10)6-11(10)13-4-5-14-11/h7-9H,2-6H2,1H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | PYTPTBDETNAGLY-DOLQZWNJSA-N |
| XLogP | 0.70 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|