C9H12O5 — CID 87274105
2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylic acid (PubChem CID 87274105) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylic acid.
| Compound Name | 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87274105 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylic acid |
| SMILES | CC1C2OC2CC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C9H12O5/c1-3-6(9(12)13)4(8(10)11)2-5-7(3)14-5/h3-7H,2H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | XVTATMFSUFIJPN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|