C27H48O5 — CID 139816928
bis(3,5,5-trimethylhexyl) 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 139816928) has the molecular formula C27H48O5 and a molecular weight of 452.68 g/mol. Its IUPAC name is bis(3,5,5-trimethylhexyl) 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | bis(3,5,5-trimethylhexyl) 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 139816928 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | bis(3,5,5-trimethylhexyl) 2-methyl-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CC(CCOC(=O)C1CC2OC2C(C)C1C(=O)OCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C27H48O5/c1-17(15-26(4,5)6)10-12-30-24(28)20-14-21-23(32-21)19(3)22(20)25(29)31-13-11-18(2)16-27(7,8)9/h17-23H,10-16H2,1-9H3 |
| InChIKey | TVCOJWCWNUNPBT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|