C18H30O6 — CID 139914231
bis(2,2-dimethylpropyl) 7,8-dioxabicyclo[4.2.0]octane-2,3-dicarboxylate (PubChem CID 139914231) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 7,8-dioxabicyclo[4.2.0]octane-2,3-dicarboxylate.
| Compound Name | bis(2,2-dimethylpropyl) 7,8-dioxabicyclo[4.2.0]octane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139914231 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | bis(2,2-dimethylpropyl) 7,8-dioxabicyclo[4.2.0]octane-2,3-dicarboxylate |
| SMILES | CC(C)(C)COC(=O)C1CCC2OOC2C1C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H30O6/c1-17(2,3)9-21-15(19)11-7-8-12-14(24-23-12)13(11)16(20)22-10-18(4,5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | AFKXYTVRJLQHIX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|