C22H38O6 — CID 139914237
bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate (PubChem CID 139914237) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate.
| Compound Name | bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 139914237 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate |
| SMILES | CCCCC(C)(C)OC(=O)C1CCC(C(=O)OC(C)(C)CCCC)C2OOC12 |
| InChI | InChI=1S/C22H38O6/c1-7-9-13-21(3,4)25-19(23)15-11-12-16(18-17(15)27-28-18)20(24)26-22(5,6)14-10-8-2/h15-18H,7-14H2,1-6H3 |
| InChIKey | YSUVUEFRHHKPNE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|