About bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate
bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate (PubChem CID 139914237) has the molecular formula C22H38O6
and a molecular weight of 398.54 g/mol. Its IUPAC name is bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate |
| PubChem CID | 139914237 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate |
| SMILES | CCCCC(C)(C)OC(=O)C1CCC(C(=O)OC(C)(C)CCCC)C2OOC12 |
| InChI | InChI=1S/C22H38O6/c1-7-9-13-21(3,4)25-19(23)15-11-12-16(18-17(15)27-28-18)20(24)26-22(5,6)14-10-8-2/h15-18H,7-14H2,1-6H3 |
| InChIKey | YSUVUEFRHHKPNE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate?
The IUPAC name of bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate (CID 139914237) is bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate.
What is the SMILES notation for bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate?
The canonical SMILES for bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate is CCCCC(C)(C)OC(=O)C1CCC(C(=O)OC(C)(C)CCCC)C2OOC12.
What is the InChIKey of bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate?
The InChIKey is YSUVUEFRHHKPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O6/c1-7-9-13-21(3,4)25-19(23)15-11-12-16(18-17(15)27-28-18)20(24)26-22(5,6)14-10-8-2/h15-18H,7-14H2,1-6H3.
What are the key properties of bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate?
bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate has a molecular weight of 398.54 g/mol, XLogP of 4.74, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylhexan-2-yl) 7,8-dioxabicyclo[4.2.0]octane-2,5-dicarboxylate is sourced from PubChem (CID 139914237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).