C15H26O4 — CID 141263047
4-(2-methylhexan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141263047) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-(2-methylhexan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(2-methylhexan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141263047 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-(2-methylhexan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC(C)(C)OC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H26O4/c1-4-5-10-15(2,3)19-14(18)12-8-6-11(7-9-12)13(16)17/h11-12H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | OAWQZNXPYBZBJM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |