C19H34O4 — CID 141262964
4-(2,8-dimethylnonan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141262964) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-(2,8-dimethylnonan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(2,8-dimethylnonan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262964 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 4-(2,8-dimethylnonan-2-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCCCCC(C)(C)OC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H34O4/c1-14(2)8-6-5-7-13-19(3,4)23-18(22)16-11-9-15(10-12-16)17(20)21/h14-16H,5-13H2,1-4H3,(H,20,21) |
| InChIKey | YWIAZUQGZOQJAK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|