C29H54O4 — CID 141262721
4-(19-methylicosan-9-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141262721) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is 4-(19-methylicosan-9-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(19-methylicosan-9-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262721 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | 4-(19-methylicosan-9-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCCC(CCCCCCCCCC(C)C)OC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C29H54O4/c1-4-5-6-7-12-15-18-27(19-16-13-10-8-9-11-14-17-24(2)3)33-29(32)26-22-20-25(21-23-26)28(30)31/h24-27H,4-23H2,1-3H3,(H,30,31) |
| InChIKey | SSVPHRFTMIAFIR-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|