C26H48O4 — CID 141262658
4-(16-methylheptadecan-7-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141262658) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is 4-(16-methylheptadecan-7-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(16-methylheptadecan-7-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262658 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | 4-(16-methylheptadecan-7-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCC(CCCCCCCCC(C)C)OC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C26H48O4/c1-4-5-6-12-15-24(16-13-10-8-7-9-11-14-21(2)3)30-26(29)23-19-17-22(18-20-23)25(27)28/h21-24H,4-20H2,1-3H3,(H,27,28) |
| InChIKey | BQAACKIYOKWDCC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|