C9H12O5 — CID 138633499
(1S,4S)-4-methoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 138633499) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1S,4S)-4-methoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | (1S,4S)-4-methoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 138633499 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1S,4S)-4-methoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | COC(=O)[C@H]1CC2O[C@H]2CC1C(=O)O |
| InChI | InChI=1S/C9H12O5/c1-13-9(12)5-3-7-6(14-7)2-4(5)8(10)11/h4-7H,2-3H2,1H3,(H,10,11)/t4?,5-,6-,7?/m0/s1 |
| InChIKey | JCYGREWDKNWNNR-GRBLJGJFSA-N |
| XLogP | 0.04 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|