methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate

C8H14O3 — CID 121226767

IUPACmethyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate
SMILESCOC(=O)C1C[C@@H](C)O[C@@H]1C
InChIInChI=1S/C8H14O3/c1-5-4-7(6(2)11-5)8(9)10-3/h5-7H,4H2,1-3H3/t5-,6-,7?/m1/s1
InChIKeyLTEQUHVAEQPJQB-CQMSUOBXSA-N
MW158.20 g/mol
LogP0.97
Rot. Bonds1

About methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate

methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate (PubChem CID 121226767) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate.

Molecular Properties

Compound Namemethyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate
PubChem CID121226767
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Namemethyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate
SMILESCOC(=O)C1C[C@@H](C)O[C@@H]1C
InChIInChI=1S/C8H14O3/c1-5-4-7(6(2)11-5)8(9)10-3/h5-7H,4H2,1-3H3/t5-,6-,7?/m1/s1
InChIKeyLTEQUHVAEQPJQB-CQMSUOBXSA-N
XLogP0.97
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate?
The IUPAC name of methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate (CID 121226767) is methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate.
What is the SMILES notation for methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate?
The canonical SMILES for methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate is COC(=O)C1C[C@@H](C)O[C@@H]1C.
What is the InChIKey of methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate?
The InChIKey is LTEQUHVAEQPJQB-CQMSUOBXSA-N. The full InChI is InChI=1S/C8H14O3/c1-5-4-7(6(2)11-5)8(9)10-3/h5-7H,4H2,1-3H3/t5-,6-,7?/m1/s1.
What are the key properties of methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate?
methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate has a molecular weight of 158.20 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,5R)-2,5-dimethyloxolane-3-carboxylate is sourced from PubChem (CID 121226767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).