C8H15NO3 — CID 110192673
methyl 2,6-dimethylmorpholine-3-carboxylate (PubChem CID 110192673) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is methyl 2,6-dimethylmorpholine-3-carboxylate.
| Compound Name | methyl 2,6-dimethylmorpholine-3-carboxylate |
|---|---|
| PubChem CID | 110192673 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | methyl 2,6-dimethylmorpholine-3-carboxylate |
| SMILES | COC(=O)C1NCC(C)OC1C |
| InChI | InChI=1S/C8H15NO3/c1-5-4-9-7(6(2)12-5)8(10)11-3/h5-7,9H,4H2,1-3H3 |
| InChIKey | JYYNIZRZHZAGBB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |