C10H18O2 — CID 130785463
1-(2,5-dimethyloxolan-3-yl)butan-1-one (PubChem CID 130785463) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-(2,5-dimethyloxolan-3-yl)butan-1-one.
| Compound Name | 1-(2,5-dimethyloxolan-3-yl)butan-1-one |
|---|---|
| PubChem CID | 130785463 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-(2,5-dimethyloxolan-3-yl)butan-1-one |
| SMILES | CCCC(=O)C1CC(C)OC1C |
| InChI | InChI=1S/C10H18O2/c1-4-5-10(11)9-6-7(2)12-8(9)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZYKOOVUPAVATCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |