C7H10O5 — CID 70497791
5-methyloxolane-2,3-dicarboxylic acid (PubChem CID 70497791) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 5-methyloxolane-2,3-dicarboxylic acid.
| Compound Name | 5-methyloxolane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70497791 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5-methyloxolane-2,3-dicarboxylic acid |
| SMILES | CC1CC(C(=O)O)C(C(=O)O)O1 |
| InChI | InChI=1S/C7H10O5/c1-3-2-4(6(8)9)5(12-3)7(10)11/h3-5H,2H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | GFDLBOBWQZHESD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |