C7H11BF3O- — CID 176722661
[(1R,2R)-2-butanoylcyclopropyl]-trifluoroboranuide (PubChem CID 176722661) has the molecular formula C7H11BF3O- and a molecular weight of 178.97 g/mol. Its IUPAC name is [(1R,2R)-2-butanoylcyclopropyl]-trifluoroboranuide.
| Compound Name | [(1R,2R)-2-butanoylcyclopropyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 176722661 |
| Molecular Formula | C7H11BF3O- |
| Molecular Weight | 178.97 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [(1R,2R)-2-butanoylcyclopropyl]-trifluoroboranuide |
| SMILES | CCCC(=O)[C@@H]1C[C@H]1[B-](F)(F)F |
| InChI | InChI=1S/C7H11BF3O/c1-2-3-7(12)5-4-6(5)8(9,10)11/h5-6H,2-4H2,1H3/q-1/t5-,6-/m1/s1 |
| InChIKey | AHAWGFXKBVIRPH-PHDIDXHHSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.97 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|