About butanoic acid;2-methyloxirane
butanoic acid;2-methyloxirane (PubChem CID 159918705) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is butanoic acid;2-methyloxirane.
Molecular Properties
| Compound Name | butanoic acid;2-methyloxirane |
| PubChem CID | 159918705 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | butanoic acid;2-methyloxirane |
| SMILES | CC1CO1.CCCC(=O)O |
| InChI | InChI=1S/C4H8O2.C3H6O/c1-2-3-4(5)6;1-3-2-4-3/h2-3H2,1H3,(H,5,6);3H,2H2,1H3 |
| InChIKey | NYCVWOGQRYKIHQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butanoic acid;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;2-methyloxirane?
The IUPAC name of butanoic acid;2-methyloxirane (CID 159918705) is butanoic acid;2-methyloxirane.
What is the SMILES notation for butanoic acid;2-methyloxirane?
The canonical SMILES for butanoic acid;2-methyloxirane is CC1CO1.CCCC(=O)O.
What is the InChIKey of butanoic acid;2-methyloxirane?
The InChIKey is NYCVWOGQRYKIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H6O/c1-2-3-4(5)6;1-3-2-4-3/h2-3H2,1H3,(H,5,6);3H,2H2,1H3.
What are the key properties of butanoic acid;2-methyloxirane?
butanoic acid;2-methyloxirane has a molecular weight of 146.19 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;2-methyloxirane is sourced from PubChem (CID 159918705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).