C9H12Br2O4 — CID 124748725
(1R,2R,3S,4S,5R)-4,5-dibromo-3-methylcyclohexane-1,2-dicarboxylic acid (PubChem CID 124748725) has the molecular formula C9H12Br2O4 and a molecular weight of 344.00 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R)-4,5-dibromo-3-methylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1R,2R,3S,4S,5R)-4,5-dibromo-3-methylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 124748725 |
| Molecular Formula | C9H12Br2O4 |
| Molecular Weight | 344.00 g/mol |
| Exact Mass | 341.91 |
| IUPAC Name | (1R,2R,3S,4S,5R)-4,5-dibromo-3-methylcyclohexane-1,2-dicarboxylic acid |
| SMILES | C[C@@H]1[C@H](Br)[C@H](Br)C[C@@H](C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C9H12Br2O4/c1-3-6(9(14)15)4(8(12)13)2-5(10)7(3)11/h3-7H,2H2,1H3,(H,12,13)(H,14,15)/t3-,4+,5+,6-,7-/m0/s1 |
| InChIKey | ZLBZDHSWWOYOSK-XUVCUMPTSA-N |
| XLogP | 1.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.00 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|