C19H28O4 — CID 23561075
1,3-dioxan-5-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 23561075) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1,3-dioxan-5-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1,3-dioxan-5-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 23561075 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1,3-dioxan-5-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C(=O)OC4COCOC4)C(C3)C21 |
| InChI | InChI=1S/C19H28O4/c1-9-10(2)14-5-13(9)17-11-3-15(18(14)17)16(4-11)19(20)23-12-6-21-8-22-7-12/h9-18H,3-8H2,1-2H3 |
| InChIKey | QEODDFGKOUQHSO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|