C25H40O4 — CID 20729166
1,3-dioxolan-2-ylmethyl 7-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)heptanoate (PubChem CID 20729166) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 1,3-dioxolan-2-ylmethyl 7-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)heptanoate.
| Compound Name | 1,3-dioxolan-2-ylmethyl 7-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)heptanoate |
|---|---|
| PubChem CID | 20729166 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 1,3-dioxolan-2-ylmethyl 7-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)heptanoate |
| SMILES | CC1C(C)C2CC1C1C3CC(CCCCCCC(=O)OCC4OCCO4)C(C3)C21 |
| InChI | InChI=1S/C25H40O4/c1-15-16(2)20-13-19(15)24-18-11-17(21(12-18)25(20)24)7-5-3-4-6-8-22(26)29-14-23-27-9-10-28-23/h15-21,23-25H,3-14H2,1-2H3 |
| InChIKey | GJCUCSGELFPYMR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|