C16H26O3 — CID 20657367
1-ethoxyethyl 8-methyltricyclo[5.2.1.02,6]decane-4-carboxylate (PubChem CID 20657367) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-ethoxyethyl 8-methyltricyclo[5.2.1.02,6]decane-4-carboxylate.
| Compound Name | 1-ethoxyethyl 8-methyltricyclo[5.2.1.02,6]decane-4-carboxylate |
|---|---|
| PubChem CID | 20657367 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-ethoxyethyl 8-methyltricyclo[5.2.1.02,6]decane-4-carboxylate |
| SMILES | CCOC(C)OC(=O)C1CC2C3CC(C)C(C3)C2C1 |
| InChI | InChI=1S/C16H26O3/c1-4-18-10(3)19-16(17)12-7-14-11-5-9(2)13(6-11)15(14)8-12/h9-15H,4-8H2,1-3H3 |
| InChIKey | LJWDWYDJWJGQBR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|