C26H38O7 — CID 20707336
5-[6-(diethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 20707336) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is 5-[6-(diethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 5-[6-(diethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 20707336 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-[6-(diethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(OCC)C1CC2CC1C(C1C3CC(C(=O)O)C(C3)C1C)C2C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C26H38O7/c1-5-31-26(32-6-2)18-10-14-8-16(18)22(21(14)20-12(4)24(29)33-25(20)30)19-11(3)15-7-13(19)9-17(15)23(27)28/h11-22,26H,5-10H2,1-4H3,(H,27,28) |
| InChIKey | LRUBPRDGRJNDHH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|