C20H24O — CID 139969688
9-methyl-9-phenylmethoxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 139969688) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 9-methyl-9-phenylmethoxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-methyl-9-phenylmethoxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 139969688 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 9-methyl-9-phenylmethoxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | CC1(OCc2ccccc2)CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C20H24O/c1-20(21-12-13-5-3-2-4-6-13)11-16-10-17(20)19-15-8-7-14(9-15)18(16)19/h2-8,14-19H,9-12H2,1H3 |
| InChIKey | WLBPOOSHFRRRMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|