3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride

C8H7ClF4O — CID 88835361

IUPAC3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride
SMILESCC1C(C=CC(=O)Cl)C(F)(F)C1(F)F
InChIInChI=1S/C8H7ClF4O/c1-4-5(2-3-6(9)14)8(12,13)7(4,10)11/h2-5H,1H3
InChIKeyVXXKOPKBGNNPHV-UHFFFAOYSA-N
MW230.59 g/mol
LogP2.84
Rot. Bonds2

About 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride

3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride (PubChem CID 88835361) has the molecular formula C8H7ClF4O and a molecular weight of 230.59 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride.

Molecular Properties

Compound Name3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride
PubChem CID88835361
Molecular FormulaC8H7ClF4O
Molecular Weight230.59 g/mol
Exact Mass230.01
IUPAC Name3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride
SMILESCC1C(C=CC(=O)Cl)C(F)(F)C1(F)F
InChIInChI=1S/C8H7ClF4O/c1-4-5(2-3-6(9)14)8(12,13)7(4,10)11/h2-5H,1H3
InChIKeyVXXKOPKBGNNPHV-UHFFFAOYSA-N
XLogP2.84
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.59
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride?
The IUPAC name of 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride (CID 88835361) is 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride.
What is the SMILES notation for 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride?
The canonical SMILES for 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride is CC1C(C=CC(=O)Cl)C(F)(F)C1(F)F.
What is the InChIKey of 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride?
The InChIKey is VXXKOPKBGNNPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF4O/c1-4-5(2-3-6(9)14)8(12,13)7(4,10)11/h2-5H,1H3.
What are the key properties of 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride?
3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride has a molecular weight of 230.59 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride is sourced from PubChem (CID 88835361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).