C8H7ClF4O — CID 163880857
2-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride (PubChem CID 163880857) has the molecular formula C8H7ClF4O and a molecular weight of 230.59 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride.
| Compound Name | 2-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 163880857 |
| Molecular Formula | C8H7ClF4O |
| Molecular Weight | 230.59 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoro-4-methylcyclobutyl)prop-2-enoyl chloride |
| SMILES | C=C(C(=O)Cl)C1C(C)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H7ClF4O/c1-3(6(9)14)5-4(2)7(10,11)8(5,12)13/h4-5H,1H2,2H3 |
| InChIKey | PTBPIEJRHRAOAV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|